| English Name: | Nimustine hydrochloride | |
| CAS NO: | 55661-38-6;52208-23-8 | |
| Molecular weight: | 309.15 | |
| EC NO: | None | |
| Molecular Formula: | C9H13ClN6O2·HCl;C9H14Cl2 | |
| InChI: | InChI=1/C9H13ClN6O2.ClH/c1-6-12-4-7(8(11)14-6)5-13-9(17)16(15-18)3-2-10;/h4H,2-3,5H2,1H3,(H,13,17)(H2,11,12,14);1H | |
| Alias: | 1- [(4-amino-2-methyl-5-pyrimidinyl) methyl] -3- (2-chloroethyl) -3-nitrosourea hydrochloride; Nimustine hydrochloride | |
| Structural Formula: | ||
Add: Within the territory of the former Denglin Farm Sanfanchang, Liushui Town, Yicheng City, Hubei Province
Contact: Manager Yang
Tel: +86-13797666691
Tel: +86-710-4280293
MicrostationMobile versionCopyright(C)2021,Hubei Zhihua Pharmaceutical Chemistry Co., Ltd. Supported by ChemNet ChinaChemNet Toocle 31fabu Copyright Notice
