| English Name: | 2-Tridecanone | |
| CAS NO: | 593-08-8 | |
| Molecular weight: | 198.35 | |
| EC NO: | 209-784-0 | |
| Molecular Formula: | C13H26O | |
| InChI: | InChI=1/C13H26O/c1-3-4-5-6-7-8-9-10-11-12-13(2)14/h3-12H2,1-2H3 | |
| Alias: | 2-Tetradecanone | |
| Structural Formula: | ||
Add: Within the territory of the former Denglin Farm Sanfanchang, Liushui Town, Yicheng City, Hubei Province
Contact: Manager Yang
Tel: +86-13797666691
Tel: +86-710-4280293
MicrostationMobile versionCopyright(C)2021,Hubei Zhihua Pharmaceutical Chemistry Co., Ltd. Supported by ChemNet ChinaChemNet Toocle 31fabu Copyright Notice
