| English Name: | bendazol | |
| CAS NO: | 621-72-7 | |
| Molecular weight: | 208.26 | |
| EC NO: | 210-703-6 | |
| Molecular Formula: | C14H12N2 | |
| InChI: | InChI=1/C14H12N2/c1-2-6-11(7-3-1)10-14-15-12-8-4-5-9-13(12)16-14/h1-9H,10H2,(H,15,16) | |
| Alias: | 2-benzylbenzimidazole | |
| Structural Formula: | ||
Add: Within the territory of the former Denglin Farm Sanfanchang, Liushui Town, Yicheng City, Hubei Province
Contact: Manager Yang
Tel: +86-13797666691
Tel: +86-710-4280293
MicrostationMobile versionCopyright(C)2021,Hubei Zhihua Pharmaceutical Chemistry Co., Ltd. Supported by ChemNet ChinaChemNet Toocle 31fabu Copyright Notice
