
| English Name: | procarbazine hydrochloride | |
| CAS NO: | 366-70-1 | |
| Molecular weight: | 257.7597 | |
| EC NO: | 206-678-6 | |
| Molecular Formula: | C12H20ClN3O | |
| InChI: | InChI=1/C12H19N3O.ClH/c1-9(2)15-12(16)11-6-4-10(5-7-11)8-14-13-3;/h4-7,9,13-14H,8H2,1-3H3,(H,15,16);1H | |
| Alias: | Methyl benzyl hydrazine hydrochloride; N-isopropyl-4- ((2-methylhydrazine) methyl) benzamide hydrochloride;procarbazine hydrochloride | |
| Structural Formula: | ||
Add: Within the territory of the former Denglin Farm Sanfanchang, Liushui Town, Yicheng City, Hubei Province
Contact: Manager Yang
Tel: +86-13797666691
Tel: +86-710-4280293
Microstation
Mobile versionCopyright(C)2021,Hubei Zhihua Pharmaceutical Chemistry Co., Ltd. Supported by ChemNet ChinaChemNet Toocle 31fabu Copyright Notice