
| English Name: | Balofloxacin | |
| CAS NO: | 127294-70-6 | |
| Molecular weight: | 389.4207 | |
| EC NO: | None | |
| Molecular Formula: | C20H24FN3O4 | |
| InChI: | InChI=1/C20H24FN3O4/c1-22-11-4-3-7-23(9-11)17-15(21)8-13-16(19(17)28-2)24(12-5-6-12)10-14(18(13)25)20(26)27/h8,10-12,22H,3-7,9H2,1-2H3,(H,26,27)/t11-/m1/s1 | |
| Alias: | Balofloxacin; 1-cyclopropyl-6-fluoro-8-methoxy-7- [3- (methylamino) piperidin-1-yl] -4-oxo-1,4-dihydroquinoline-3-carboxylic acid dihydrate; 1-cyclopropyl-7- (3-methylamino-1-piperidinyl) -8-methoxy-6-fluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid | |
| Structural Formula: | ||
Add: Within the territory of the former Denglin Farm Sanfanchang, Liushui Town, Yicheng City, Hubei Province
Contact: Manager Yang
Tel: +86-13797666691
Tel: +86-710-4280293
Microstation
Mobile versionCopyright(C)2021,Hubei Zhihua Pharmaceutical Chemistry Co., Ltd. Supported by ChemNet ChinaChemNet Toocle 31fabu Copyright Notice