| English Name: | 1-fluoronaphthalene | |
| CAS NO: | 321-38-0 | |
| Molecular weight: | 172.1983 | |
| EC NO: | 206-287-0 | |
| Molecular Formula: | C12H9F | |
| InChI: | InChI=1/C12H9F/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H | |
| Alias: | 1-Fluoronaphthalene& Alpha; - fluorinated naphthalene | |
| Structural Formula: | ||
Add: Within the territory of the former Denglin Farm Sanfanchang, Liushui Town, Yicheng City, Hubei Province
Contact: Manager Yang
Tel: +86-13797666691
Tel: +86-710-4280293
MicrostationMobile versionCopyright(C)2021,Hubei Zhihua Pharmaceutical Chemistry Co., Ltd. Supported by ChemNet ChinaChemNet Toocle 31fabu Copyright Notice
