| English Name: | metaraminol bitartrate | |
| CAS NO: | 33402-03-8 | |
| Molecular weight: | 317.2919 | |
| EC NO: | 251-502-3 | |
| Molecular Formula: | C13H19NO8 | |
| InChI: | InChI=1/C9H13NO2.C4H6O6/c1-6(10)9(12)7-3-2-4-8(11)5-7;5-1(3(7)8)2(6)4(9)10/h2-6,9,11-12H,10H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t6-,9-;/m0./s1 | |
| Alias: | Aramine | |
| Structural Formula: | ||
Add: Within the territory of the former Denglin Farm Sanfanchang, Liushui Town, Yicheng City, Hubei Province
Contact: Manager Yang
Tel: +86-13797666691
Tel: +86-710-4280293
MicrostationMobile versionCopyright(C)2021,Hubei Zhihua Pharmaceutical Chemistry Co., Ltd. Supported by ChemNet ChinaChemNet Toocle 31fabu Copyright Notice
